CAS 16962-40-6 appears in our catalog under these names: Ammonium hexafluorotitanate, 95%, Ammonium hexafluorotitanate, 99.99% (metals basis) , Ammonium Hexafluorotitanate(IV), >97.0%(T), Ammonium hexafluorotitanate(IV), 99.99%, (trace metal basis), AMMONIUM HEXAFLUOROTITANATE(IV), 99.99%&. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 1g, 100g, 500g, 25g, 5g, 10g, 50g, 250g.
Diazanium;hexafluorotitanium(2-) (CAS 16962-40-6) is a chemical compound with the molecular formula F6H8N2Ti and a molecular weight of 197.935 g/mol. IUPAC name: diazanium;hexafluorotitanium(2-). InChIKey: NMGYKLMMQCTUGI-UHFFFAOYSA-J.
| Molecular formula | F6H8N2Ti |
|---|---|
| Molecular weight | 197.935 g/mol |
| IUPAC name | diazanium;hexafluorotitanium(2-) |
| InChIKey | NMGYKLMMQCTUGI-UHFFFAOYSA-J |
| SMILES | [NH4+].[NH4+].F[Ti-2](F)(F)(F)(F)F |
Computed by PubChem (NCBI)