Products 1696265-12-9

CAS 1696265-12-9 is the registry number for 2-Acetylthiazole-5-sulfonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-acetyl-1,3-thiazole-5-sulfonyl chloride (CAS 1696265-12-9) is a chemical compound with the molecular formula C5H4ClNO3S2 and a molecular weight of 225.7 g/mol. IUPAC name: 2-acetyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: XTGSCRYSUBDONO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClNO3S2
Molecular weight225.7 g/mol
IUPAC name2-acetyl-1,3-thiazole-5-sulfonyl chloride
InChIKeyXTGSCRYSUBDONO-UHFFFAOYSA-N
SMILESCC(=O)C1=NC=C(S1)S(=O)(=O)Cl

Computed by PubChem (NCBI)