CAS 1696343-30-2 is the registry number for 3-Bromo-α-(1,1-dimethylethyl)-2,6-difluoro-α-methylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3-bromo-2,6-difluorophenyl)-3,3-dimethylbutan-2-ol (CAS 1696343-30-2) is a chemical compound with the molecular formula C12H15BrF2O and a molecular weight of 293.15 g/mol. IUPAC name: 2-(3-bromo-2,6-difluorophenyl)-3,3-dimethylbutan-2-ol. InChIKey: KGQYSDBDUUHWLS-UHFFFAOYSA-N.
| Molecular formula | C12H15BrF2O |
|---|---|
| Molecular weight | 293.15 g/mol |
| IUPAC name | 2-(3-bromo-2,6-difluorophenyl)-3,3-dimethylbutan-2-ol |
| InChIKey | KGQYSDBDUUHWLS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C)(C1=C(C=CC(=C1F)Br)F)O |
Computed by PubChem (NCBI)