Products 1696392-11-6
CAS 1696392-11-6 appears in our catalog under these names: Azilsartan Impurity A, Azilsartan Impurity 3, Azilsartan Impurity 2, 1-'((2'-'Carbamoylbiphenyl-'4-'yl) methyl)'-'2-'ethoxybenzimidazole-'7-'carboxylic Acid, >95% (HPLC), 1-((2'-Carbamoylbiphenyl-4-yl) methyl)-2-ethoxybenzimidazole-7-carboxylic Acid, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
3-[[4-(2-carbamoylphenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid (CAS 1696392-11-6) is a chemical compound with the molecular formula C24H21N3O4 and a molecular weight of 415.4 g/mol. IUPAC name: 3-[[4-(2-carbamoylphenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid. InChIKey: DEKJJZVBGQUKPQ-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O4 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | 3-[[4-(2-carbamoylphenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid |
| InChIKey | DEKJJZVBGQUKPQ-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)N)C(=O)O |
Computed by PubChem (NCBI)