Products 1696426-78-4

CAS 1696426-78-4 is the registry number for 1-Ethyl 3-Methyl 2-(2-(2-amino-6-chloro-9H-purin-9-yl)ethyl)malonate. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

1-O-ethyl 3-O-methyl 2-[2-(2-amino-6-chloropurin-9-yl)ethyl]propanedioate (CAS 1696426-78-4) is a chemical compound with the molecular formula C13H16ClN5O4 and a molecular weight of 341.75 g/mol. IUPAC name: 1-O-ethyl 3-O-methyl 2-[2-(2-amino-6-chloropurin-9-yl)ethyl]propanedioate. InChIKey: YJURUIOHBYAOFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClN5O4
Molecular weight341.75 g/mol
IUPAC name1-O-ethyl 3-O-methyl 2-[2-(2-amino-6-chloropurin-9-yl)ethyl]propanedioate
InChIKeyYJURUIOHBYAOFQ-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCN1C=NC2=C1N=C(N=C2Cl)N)C(=O)OC

Computed by PubChem (NCBI)