CAS 16965-06-3 appears in our catalog under these names: Boc–Lys(Tfa)–OH, Boc-L-Lys(TFA)-OH, Boc-Lys(Tfa)-OH 98%, N2-Boc-N6-(2,2,2-trifluoroacetyl)-L-lysine, 98%, 98%, (S)-2-((tert-Butoxycarbonyl)amino)-6-(2,2,2-trifluoroacetamido)hexanoic acid, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 16965-06-3) is a chemical compound with the molecular formula C13H21F3N2O5 and a molecular weight of 342.31 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: DEIYNDIFGSDDCY-QMMMGPOBSA-N.
| Molecular formula | C13H21F3N2O5 |
|---|---|
| Molecular weight | 342.31 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| InChIKey | DEIYNDIFGSDDCY-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)