Products 1696588-54-1
CAS 1696588-54-1 appears in our catalog under these names: (2–(3，5–difluorophenyl)cyclopropyl)methanol, (2-(3,5-difluorophenyl)cyclopropyl)methanol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 5g.
[2-(3,5-difluorophenyl)cyclopropyl]methanol (CAS 1696588-54-1) is a chemical compound with the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. IUPAC name: [2-(3,5-difluorophenyl)cyclopropyl]methanol. InChIKey: VUBHQXODHNUPSH-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | [2-(3,5-difluorophenyl)cyclopropyl]methanol |
| InChIKey | VUBHQXODHNUPSH-UHFFFAOYSA-N |
| SMILES | C1C(C1C2=CC(=CC(=C2)F)F)CO |
Computed by PubChem (NCBI)