CAS 1696869-37-0 is the registry number for 4-(3-Aminoisothiazol-5-yl)thiomorpholine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1,1-dioxo-1,4-thiazinan-4-yl)-1,2-thiazol-3-amine (CAS 1696869-37-0) is a chemical compound with the molecular formula C7H11N3O2S2 and a molecular weight of 233.3 g/mol. IUPAC name: 5-(1,1-dioxo-1,4-thiazinan-4-yl)-1,2-thiazol-3-amine. InChIKey: JAKNVNNLCRTBNO-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2S2 |
|---|---|
| Molecular weight | 233.3 g/mol |
| IUPAC name | 5-(1,1-dioxo-1,4-thiazinan-4-yl)-1,2-thiazol-3-amine |
| InChIKey | JAKNVNNLCRTBNO-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC(=NS2)N |
Computed by PubChem (NCBI)