CAS 1697697-05-4 is the registry number for Sodium 2-cyclohexyl-1-hydroxyethanesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Sodium 2-cyclohexyl-1-hydroxyethanesulfonate (CAS 1697697-05-4) is a chemical compound with the molecular formula C8H15NaO4S and a molecular weight of 230.26 g/mol. IUPAC name: sodium 2-cyclohexyl-1-hydroxyethanesulfonate. InChIKey: OGHWYTJHABHOGB-UHFFFAOYSA-M.
| Molecular formula | C8H15NaO4S |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | sodium 2-cyclohexyl-1-hydroxyethanesulfonate |
| InChIKey | OGHWYTJHABHOGB-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)CC(O)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)