CAS 1698027-58-5 is the registry number for tert-Butyl 4-(7-bromo-6,8-dichloroquinazolin-4-yl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(7-bromo-6,8-dichloroquinazolin-4-yl)piperazine-1-carboxylate (CAS 1698027-58-5) is a chemical compound with the molecular formula C17H19BrCl2N4O2 and a molecular weight of 462.2 g/mol. IUPAC name: tert-butyl 4-(7-bromo-6,8-dichloroquinazolin-4-yl)piperazine-1-carboxylate. InChIKey: HONKEVBOWIKPPT-UHFFFAOYSA-N.
| Molecular formula | C17H19BrCl2N4O2 |
|---|---|
| Molecular weight | 462.2 g/mol |
| IUPAC name | tert-butyl 4-(7-bromo-6,8-dichloroquinazolin-4-yl)piperazine-1-carboxylate |
| InChIKey | HONKEVBOWIKPPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=NC3=C(C(=C(C=C32)Cl)Br)Cl |
Computed by PubChem (NCBI)