Products 1698050-47-3

CAS 1698050-47-3 is the registry number for Cariprazine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2-[4-(dimethylcarbamoylamino)cyclohexylidene]acetate (CAS 1698050-47-3) is a chemical compound with the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. IUPAC name: ethyl 2-[4-(dimethylcarbamoylamino)cyclohexylidene]acetate. InChIKey: QLIKPOXFNIZPPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22N2O3
Molecular weight254.33 g/mol
IUPAC nameethyl 2-[4-(dimethylcarbamoylamino)cyclohexylidene]acetate
InChIKeyQLIKPOXFNIZPPJ-UHFFFAOYSA-N
SMILESCCOC(=O)C=C1CCC(CC1)NC(=O)N(C)C

Computed by PubChem (NCBI)