CAS 169815-40-1 appears in our catalog under these names: AQ-13 dihydrochloride/ 99.88% (existing batch purity), AQ–13 dihydrochloride, 1,3-Propanediamine, N'-(7-chloro-4-quinolinyl)-N,N-diethyl-,dihydrochloride, AQ-13 dihydrochloride, 98.08%, AQ-13 dihydrochloride (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg, 200mg.
N-(7-chloroquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride (CAS 169815-40-1) is a chemical compound with the molecular formula C16H24Cl3N3 and a molecular weight of 364.7 g/mol. IUPAC name: N-(7-chloroquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride. InChIKey: ZNHBPWZRWNFJPN-UHFFFAOYSA-N.
| Molecular formula | C16H24Cl3N3 |
|---|---|
| Molecular weight | 364.7 g/mol |
| IUPAC name | N-(7-chloroquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| InChIKey | ZNHBPWZRWNFJPN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNC1=C2C=CC(=CC2=NC=C1)Cl.Cl.Cl |
Computed by PubChem (NCBI)