Products 1698684-09-1

CAS 1698684-09-1 is the registry number for Methyl 5-oxopiperazine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-oxopiperazine-2-carboxylate (CAS 1698684-09-1) is a chemical compound with the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. IUPAC name: methyl 5-oxopiperazine-2-carboxylate. InChIKey: KLAVLUWNPFSXTG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10N2O3
Molecular weight158.16 g/mol
IUPAC namemethyl 5-oxopiperazine-2-carboxylate
InChIKeyKLAVLUWNPFSXTG-UHFFFAOYSA-N
SMILESCOC(=O)C1CNC(=O)CN1

Computed by PubChem (NCBI)