CAS 1698894-16-4 is the registry number for 4-(7,7-Dichloro-6-oxo-5-azaspiro[2.5]octan-5-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(7,7-dichloro-6-oxo-5-azaspiro[2.5]octan-5-yl)benzonitrile (CAS 1698894-16-4) is a chemical compound with the molecular formula C14H12Cl2N2O and a molecular weight of 295.2 g/mol. IUPAC name: 4-(7,7-dichloro-6-oxo-5-azaspiro[2.5]octan-5-yl)benzonitrile. InChIKey: PPPXDLSRZXIBQT-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N2O |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 4-(7,7-dichloro-6-oxo-5-azaspiro[2.5]octan-5-yl)benzonitrile |
| InChIKey | PPPXDLSRZXIBQT-UHFFFAOYSA-N |
| SMILES | C1CC12CC(C(=O)N(C2)C3=CC=C(C=C3)C#N)(Cl)Cl |
Computed by PubChem (NCBI)