CAS 1698908-90-5 is the registry number for 2-(2-Ethyl-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-ethyl-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1698908-90-5) is a chemical compound with the molecular formula C14H19BF2O2 and a molecular weight of 268.11 g/mol. IUPAC name: 2-(2-ethyl-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DITWPQHLGZUMQG-UHFFFAOYSA-N.
| Molecular formula | C14H19BF2O2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 2-(2-ethyl-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DITWPQHLGZUMQG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2CC)F)F |
Computed by PubChem (NCBI)