Products 1699251-73-4

CAS 1699251-73-4 is the registry number for tert-Butyl N-{5-((azepan-4-yl)amino)pyridin-2-yl}carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[5-(azepan-4-ylamino)-2-pyridinyl]carbamate (CAS 1699251-73-4) is a chemical compound with the molecular formula C16H26N4O2 and a molecular weight of 306.40 g/mol. IUPAC name: tert-butyl N-[5-(azepan-4-ylamino)-2-pyridinyl]carbamate. InChIKey: RZVTXSHHLKXOPS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H26N4O2
Molecular weight306.40 g/mol
IUPAC nametert-butyl N-[5-(azepan-4-ylamino)-2-pyridinyl]carbamate
InChIKeyRZVTXSHHLKXOPS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=NC=C(C=C1)NC2CCCNCC2

Computed by PubChem (NCBI)