CAS 1699258-66-6 is the registry number for Methyl (S)-3-amino-2-((5-bromo-2-fluorophenyl)amino)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-3-amino-2-(5-bromo-2-fluoroanilino)propanoate (CAS 1699258-66-6) is a chemical compound with the molecular formula C10H12BrFN2O2 and a molecular weight of 291.12 g/mol. IUPAC name: methyl (2S)-3-amino-2-(5-bromo-2-fluoroanilino)propanoate. InChIKey: GBYHJZUTTCFWTN-VIFPVBQESA-N.
| Molecular formula | C10H12BrFN2O2 |
|---|---|
| Molecular weight | 291.12 g/mol |
| IUPAC name | methyl (2S)-3-amino-2-(5-bromo-2-fluoroanilino)propanoate |
| InChIKey | GBYHJZUTTCFWTN-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CN)NC1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)