Products 1699434-70-2
CAS 1699434-70-2 is the registry number for Fmoc-4,4-DfHPhe-OH (rac.). Offered by: Iris Biotech. Available pack sizes: 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-difluoro-4-phenylbutanoic acid (CAS 1699434-70-2) is a chemical compound with the molecular formula C25H21F2NO4 and a molecular weight of 437.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-difluoro-4-phenylbutanoic acid. InChIKey: LYMRDWBTRZYKGY-UHFFFAOYSA-N.
| Molecular formula | C25H21F2NO4 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-difluoro-4-phenylbutanoic acid |
| InChIKey | LYMRDWBTRZYKGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(F)F |
Computed by PubChem (NCBI)