CAS 1699532-58-5 is the registry number for tert-Butyl 3-((3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl)methyl)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]azetidine-1-carboxylate (CAS 1699532-58-5) is a chemical compound with the molecular formula C16H20N4O3 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 3-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]azetidine-1-carboxylate. InChIKey: NNGQGSNKLDVYKV-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O3 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | tert-butyl 3-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]azetidine-1-carboxylate |
| InChIKey | NNGQGSNKLDVYKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)CC2=NC(=NO2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)