CAS 1461715-42-3 is the registry number for Benzyl 3-(4-(2-hydroxypropan-2-yl)-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl 3-[4-(2-hydroxypropan-2-yl)triazol-1-yl]azetidine-1-carboxylate (CAS 1461715-42-3) is a chemical compound with the molecular formula C16H20N4O3 and a molecular weight of 316.35 g/mol. IUPAC name: benzyl 3-[4-(2-hydroxypropan-2-yl)triazol-1-yl]azetidine-1-carboxylate. InChIKey: RJSOZFPAEDUYGB-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O3 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | benzyl 3-[4-(2-hydroxypropan-2-yl)triazol-1-yl]azetidine-1-carboxylate |
| InChIKey | RJSOZFPAEDUYGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CN(N=N1)C2CN(C2)C(=O)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)