Products 1699742-54-5
CAS 1699742-54-5 is the registry number for (S)-4-(4-Bromo-3,5-dimethylphenoxy)butane-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-(4-bromo-3,5-dimethylphenoxy)butane-1,2-diol (CAS 1699742-54-5) is a chemical compound with the molecular formula C12H17BrO3 and a molecular weight of 289.16 g/mol. IUPAC name: (2S)-4-(4-bromo-3,5-dimethylphenoxy)butane-1,2-diol. InChIKey: DVLQQKOAXNODTL-JTQLQIEISA-N.
| Molecular formula | C12H17BrO3 |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | (2S)-4-(4-bromo-3,5-dimethylphenoxy)butane-1,2-diol |
| InChIKey | DVLQQKOAXNODTL-JTQLQIEISA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)OCC[C@@H](CO)O |
Computed by PubChem (NCBI)