Products 1700655-67-9
CAS 1700655-67-9 appears in our catalog under these names: Brexpiprazole Impurity 83, Brexpiprazole Impurity 49, 4-(Piperazin-1-yl)benzo[b]thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-piperazin-1-yl-1-benzothiophene-2-carboxylic acid (CAS 1700655-67-9) is a chemical compound with the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. IUPAC name: 4-piperazin-1-yl-1-benzothiophene-2-carboxylic acid. InChIKey: JLQSJEOZDFCSNB-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 4-piperazin-1-yl-1-benzothiophene-2-carboxylic acid |
| InChIKey | JLQSJEOZDFCSNB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=C(SC3=CC=C2)C(=O)O |
Computed by PubChem (NCBI)