CAS 170098-85-8 appears in our catalog under these names: 5–Fluoro–3–nitrobenzene–1,2–diamine, 5-Fluoro-3-nitrobenzene-1,2-diamine 95%, 5-Fluoro-3-nitrobenzene-1,2-diamine, 98%, 98%, 5-Fluoro-3-nitrobenzene-1,2-diamine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-fluoro-3-nitrobenzene-1,2-diamine (CAS 170098-85-8) is a chemical compound with the molecular formula C6H6FN3O2 and a molecular weight of 171.13 g/mol. IUPAC name: 5-fluoro-3-nitrobenzene-1,2-diamine. InChIKey: ZSMCJPBOBDFJHM-UHFFFAOYSA-N.
| Molecular formula | C6H6FN3O2 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 5-fluoro-3-nitrobenzene-1,2-diamine |
| InChIKey | ZSMCJPBOBDFJHM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)