CAS 1701402-25-6 appears in our catalog under these names: D-Glucuronic Acid 3-Phenylpropyl Ester, D-Glucuronic acid 3-phenylpropyl ester, min. 95 %, 100 mg, D-Glucuronic acid 3-phenylpropyl ester, min. 95 %, 500 mg. Offered by: Chemat Brand, TRC, Biosynth, Roth. Available pack sizes: on request, 100mg, 250mg, 25mg, 500mg.
3-phenylpropyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (CAS 1701402-25-6) is a chemical compound with the molecular formula C15H20O7 and a molecular weight of 312.31 g/mol. IUPAC name: 3-phenylpropyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate. InChIKey: DMCANNABFZDODS-CRWXNKLISA-N.
| Molecular formula | C15H20O7 |
|---|---|
| Molecular weight | 312.31 g/mol |
| IUPAC name | 3-phenylpropyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| InChIKey | DMCANNABFZDODS-CRWXNKLISA-N |
| SMILES | C1=CC=C(C=C1)CCCOC(=O)[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)