CAS 17024-12-3 appears in our catalog under these names: 9-Iodophenanthrene, 98%, 9–Iodophenanthrene, 9-Iodophenanthrene 98%, 9-Iodophenanthrene, 98%, 98%, 9-IODOPHENANTHRENE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Sigma-Aldrich. Available pack sizes: 25g, 1g, 250mg, 5g, 10g.
9-iodophenanthrene (CAS 17024-12-3) is a chemical compound with the molecular formula C14H9I and a molecular weight of 304.12 g/mol. IUPAC name: 9-iodophenanthrene. InChIKey: CBFIPOTVFMLMFQ-UHFFFAOYSA-N.
| Molecular formula | C14H9I |
|---|---|
| Molecular weight | 304.12 g/mol |
| IUPAC name | 9-iodophenanthrene |
| InChIKey | CBFIPOTVFMLMFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)I |
Computed by PubChem (NCBI)