CAS 17025-47-7 appears in our catalog under these names: Tribromomethyl Phenyl Sulfone, Tribromomethyl phenyl sulfone, Tribromomethyl Phenyl Sulfone, >97.0%(GC), ((Tribromomethyl)sulfonyl)benzene 97%, ((Tribromomethyl)sulfonyl)benzene, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 250g, 25g, 1000g, 5g, 10g.
Tribromomethylsulfonylbenzene (CAS 17025-47-7) is a chemical compound with the molecular formula C7H5Br3O2S and a molecular weight of 392.89 g/mol. IUPAC name: tribromomethylsulfonylbenzene. InChIKey: DWWMSEANWMWMCB-UHFFFAOYSA-N.
| Molecular formula | C7H5Br3O2S |
|---|---|
| Molecular weight | 392.89 g/mol |
| IUPAC name | tribromomethylsulfonylbenzene |
| InChIKey | DWWMSEANWMWMCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C(Br)(Br)Br |
Computed by PubChem (NCBI)