Products 1702577-77-2
CAS 1702577-77-2 is the registry number for 1-(4-bromo-3-chloro-2-fluorophenyl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(4-bromo-3-chloro-2-fluorophenyl)cyclobutan-1-ol (CAS 1702577-77-2) is a chemical compound with the molecular formula C10H9BrClFO and a molecular weight of 279.53 g/mol. IUPAC name: 1-(4-bromo-3-chloro-2-fluorophenyl)cyclobutan-1-ol. InChIKey: TUDUMLNYVTZVNR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClFO |
|---|---|
| Molecular weight | 279.53 g/mol |
| IUPAC name | 1-(4-bromo-3-chloro-2-fluorophenyl)cyclobutan-1-ol |
| InChIKey | TUDUMLNYVTZVNR-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C(=C(C=C2)Br)Cl)F)O |
Computed by PubChem (NCBI)