CAS 1702797-24-7 is the registry number for 3-(4-Bromo-3-chlorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-3-chlorophenyl)-2-oxopropanoic acid (CAS 1702797-24-7) is a chemical compound with the molecular formula C9H6BrClO3 and a molecular weight of 277.50 g/mol. IUPAC name: 3-(4-bromo-3-chlorophenyl)-2-oxopropanoic acid. InChIKey: OHGDUEDGJAFDFE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO3 |
|---|---|
| Molecular weight | 277.50 g/mol |
| IUPAC name | 3-(4-bromo-3-chlorophenyl)-2-oxopropanoic acid |
| InChIKey | OHGDUEDGJAFDFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)