CAS 1703-58-8 appears in our catalog under these names: 1,2,3,4-Butanetetracarboxylic acid, 98+% , 1,2,3,4-Butanetetracarboxylic acid, 99+%, 1,2,3,4-Butanetetracarboxylic acid, 98.50%, Butane-1,2,3,4-tetracarboxylic acid 98% (contains <15%H2O), 1,2,3,4-BUTANETETRACARBOXYLIC ACID, 99%. Offered by: Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Chemat, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 500g, 25g, 10g, 1000g, 50g, 1kg, 1g.
Butane-1,2,3,4-tetracarboxylic acid (CAS 1703-58-8) is a chemical compound with the molecular formula C8H10O8 and a molecular weight of 234.16 g/mol. IUPAC name: butane-1,2,3,4-tetracarboxylic acid. InChIKey: GGAUUQHSCNMCAU-UHFFFAOYSA-N.
| Molecular formula | C8H10O8 |
|---|---|
| Molecular weight | 234.16 g/mol |
| IUPAC name | butane-1,2,3,4-tetracarboxylic acid |
| InChIKey | GGAUUQHSCNMCAU-UHFFFAOYSA-N |
| SMILES | C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)