CAS 170368-42-0 appears in our catalog under these names: 3-Maleimidophenyl boronic acid, 95%, 3-Maleimidophenyl Boronic Acid, 3-Maleimidophenyl Boronic Acid, 97%(LC-MS),RG, 97%(LC-MS),RG. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 0,1g.
[3-(2,5-dioxopyrrol-1-yl)phenyl]boronic acid (CAS 170368-42-0) is a chemical compound with the molecular formula C10H8BNO4 and a molecular weight of 216.99 g/mol. IUPAC name: [3-(2,5-dioxopyrrol-1-yl)phenyl]boronic acid. InChIKey: VRWRNFAUYWXDKX-UHFFFAOYSA-N.
| Molecular formula | C10H8BNO4 |
|---|---|
| Molecular weight | 216.99 g/mol |
| IUPAC name | [3-(2,5-dioxopyrrol-1-yl)phenyl]boronic acid |
| InChIKey | VRWRNFAUYWXDKX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2C(=O)C=CC2=O)(O)O |
Computed by PubChem (NCBI)