CAS 1703910-45-5 is the registry number for (S)-2-(4-Bromo-3,6-dichloro-2-fluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4-bromo-3,6-dichloro-2-fluorophenyl)pyrrolidine (CAS 1703910-45-5) is a chemical compound with the molecular formula C10H9BrCl2FN and a molecular weight of 312.99 g/mol. IUPAC name: (2S)-2-(4-bromo-3,6-dichloro-2-fluorophenyl)pyrrolidine. InChIKey: BURNYPFWWANFRF-ZETCQYMHSA-N.
| Molecular formula | C10H9BrCl2FN |
|---|---|
| Molecular weight | 312.99 g/mol |
| IUPAC name | (2S)-2-(4-bromo-3,6-dichloro-2-fluorophenyl)pyrrolidine |
| InChIKey | BURNYPFWWANFRF-ZETCQYMHSA-N |
| SMILES | C1C[C@H](NC1)C2=C(C(=C(C=C2Cl)Br)Cl)F |
Computed by PubChem (NCBI)