CAS 1704066-72-7 appears in our catalog under these names: (3-(N-Methoxysulfamoyl)phenyl)boronic acid, 95%, (3–(N–Methoxysulfamoyl)phenyl)boronic acid, (3-(N-Methoxysulfamoyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
[3-(methoxysulfamoyl)phenyl]boronic acid (CAS 1704066-72-7) is a chemical compound with the molecular formula C7H10BNO5S and a molecular weight of 231.04 g/mol. IUPAC name: [3-(methoxysulfamoyl)phenyl]boronic acid. InChIKey: ASJYQZKDXCIXAV-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO5S |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | [3-(methoxysulfamoyl)phenyl]boronic acid |
| InChIKey | ASJYQZKDXCIXAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)NOC)(O)O |
Computed by PubChem (NCBI)