CAS 1704069-16-8 appears in our catalog under these names: (4-(1-(4-Methylpiperazin-1-yl)ethyl)phenyl)boronic acid hydrochloride, 95%, (4–(1–(4–Methylpiperazin–1–yl)ethyl)phenyl)boronic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]boronic acid;hydrochloride (CAS 1704069-16-8) is a chemical compound with the molecular formula C13H22BClN2O2 and a molecular weight of 284.59 g/mol. IUPAC name: [4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]boronic acid;hydrochloride. InChIKey: ARIHZIRAXGAVOS-UHFFFAOYSA-N.
| Molecular formula | C13H22BClN2O2 |
|---|---|
| Molecular weight | 284.59 g/mol |
| IUPAC name | [4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]boronic acid;hydrochloride |
| InChIKey | ARIHZIRAXGAVOS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)N2CCN(CC2)C)(O)O.Cl |
Computed by PubChem (NCBI)