Products 1704069-47-5
CAS 1704069-47-5 is the registry number for (4–(1–(4–(tert–Butoxycarbonyl)piperazin–1–yl)ethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-[1-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethyl]phenyl]boronic acid (CAS 1704069-47-5) is a chemical compound with the molecular formula C17H27BN2O4 and a molecular weight of 334.2 g/mol. IUPAC name: [4-[1-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethyl]phenyl]boronic acid. InChIKey: VTKYUZIJVYGJJQ-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | [4-[1-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethyl]phenyl]boronic acid |
| InChIKey | VTKYUZIJVYGJJQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)N2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)