CAS 1704073-61-9 is the registry number for (4–Chloro–3–((4–methylpiperazin–1–yl)methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-chloro-3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid (CAS 1704073-61-9) is a chemical compound with the molecular formula C12H18BClN2O2 and a molecular weight of 268.55 g/mol. IUPAC name: [4-chloro-3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid. InChIKey: UQKCTHHIOPKUKA-UHFFFAOYSA-N.
| Molecular formula | C12H18BClN2O2 |
|---|---|
| Molecular weight | 268.55 g/mol |
| IUPAC name | [4-chloro-3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | UQKCTHHIOPKUKA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)CN2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)