CAS 1704074-05-4 appears in our catalog under these names: 2–Fluoro–3–(morpholine–4–carbonyl)phenylboronic acid, 2-Fluoro-3-(morpholine-4-carbonyl)phenylboronic acid, {2-fluoro-3-[(morpholin-4-yl)carbonyl]phenyl}boronic acid, 95%. Offered by: GLPBio, Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
[2-fluoro-3-(morpholine-4-carbonyl)phenyl]boronic acid (CAS 1704074-05-4) is a chemical compound with the molecular formula C11H13BFNO4 and a molecular weight of 253.04 g/mol. IUPAC name: [2-fluoro-3-(morpholine-4-carbonyl)phenyl]boronic acid. InChIKey: UQWYKOFZFASCHO-UHFFFAOYSA-N.
| Molecular formula | C11H13BFNO4 |
|---|---|
| Molecular weight | 253.04 g/mol |
| IUPAC name | [2-fluoro-3-(morpholine-4-carbonyl)phenyl]boronic acid |
| InChIKey | UQWYKOFZFASCHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)N2CCOCC2)F)(O)O |
Computed by PubChem (NCBI)