Products 1704080-18-1
CAS 1704080-18-1 is the registry number for (4–(2–((tert–Butoxycarbonyl)(cyclopropyl)amino)ethoxy)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[4-[2-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenyl]boronic acid (CAS 1704080-18-1) is a chemical compound with the molecular formula C16H24BNO5 and a molecular weight of 321.2 g/mol. IUPAC name: [4-[2-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenyl]boronic acid. InChIKey: ULZKZUQOUVRJKC-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO5 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | [4-[2-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenyl]boronic acid |
| InChIKey | ULZKZUQOUVRJKC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCN(C2CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)