CAS 1704080-21-6 appears in our catalog under these names: (4–Chloro–3–(4–oxopiperidine–1–carbonyl)phenyl)boronic acid, (4-Chloro-3-(4-oxopiperidine-1-carbonyl)phenyl)boronic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 5g, 5000mg, 1000mg.
[4-chloro-3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid (CAS 1704080-21-6) is a chemical compound with the molecular formula C12H13BClNO4 and a molecular weight of 281.50 g/mol. IUPAC name: [4-chloro-3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: KZIWQLVIUIJIBF-UHFFFAOYSA-N.
| Molecular formula | C12H13BClNO4 |
|---|---|
| Molecular weight | 281.50 g/mol |
| IUPAC name | [4-chloro-3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | KZIWQLVIUIJIBF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)N2CCC(=O)CC2)(O)O |
Computed by PubChem (NCBI)