CAS 1704080-46-5 is the registry number for (3–Chloro–4–(2–(dimethylamino)ethoxy)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]boronic acid (CAS 1704080-46-5) is a chemical compound with the molecular formula C10H15BClNO3 and a molecular weight of 243.50 g/mol. IUPAC name: [3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]boronic acid. InChIKey: VRLUXBZKTHGGAY-UHFFFAOYSA-N.
| Molecular formula | C10H15BClNO3 |
|---|---|
| Molecular weight | 243.50 g/mol |
| IUPAC name | [3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]boronic acid |
| InChIKey | VRLUXBZKTHGGAY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCCN(C)C)Cl)(O)O |
Computed by PubChem (NCBI)