CAS 1704082-18-7 is the registry number for (3–((2–(Dimethylamino)ethyl)carbamoyl)–5–fluorophenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-[2-(dimethylamino)ethylcarbamoyl]-5-fluorophenyl]boronic acid (CAS 1704082-18-7) is a chemical compound with the molecular formula C11H16BFN2O3 and a molecular weight of 254.07 g/mol. IUPAC name: [3-[2-(dimethylamino)ethylcarbamoyl]-5-fluorophenyl]boronic acid. InChIKey: KDKFHMPSXMAELD-UHFFFAOYSA-N.
| Molecular formula | C11H16BFN2O3 |
|---|---|
| Molecular weight | 254.07 g/mol |
| IUPAC name | [3-[2-(dimethylamino)ethylcarbamoyl]-5-fluorophenyl]boronic acid |
| InChIKey | KDKFHMPSXMAELD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)NCCN(C)C)(O)O |
Computed by PubChem (NCBI)