CAS 1704082-65-4 is the registry number for (4–Methoxy–3–(N–((4–methoxycyclohexyl) methyl)sulfamoyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-methoxy-3-[(4-methoxycyclohexyl)methylsulfamoyl]phenyl]boronic acid (CAS 1704082-65-4) is a chemical compound with the molecular formula C15H24BNO6S and a molecular weight of 357.2 g/mol. IUPAC name: [4-methoxy-3-[(4-methoxycyclohexyl)methylsulfamoyl]phenyl]boronic acid. InChIKey: OIZCBXVOCRVGCF-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO6S |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | [4-methoxy-3-[(4-methoxycyclohexyl)methylsulfamoyl]phenyl]boronic acid |
| InChIKey | OIZCBXVOCRVGCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)S(=O)(=O)NCC2CCC(CC2)OC)(O)O |
Computed by PubChem (NCBI)