CAS 1704095-44-2 appears in our catalog under these names: (5–(N–Cyclopentylsulfamoyl)–2 –methoxyphenyl)boronic acid, (5-(N-Cyclopentylsulfamoyl)-2-methoxyphenyl)boronic acid, 95%, (5-(N-cyclopentylsulfamoyl)-2-methoxyphenyl)boronic acid, 98%, (5-(N-cyclopentylsulfamoyl)-2-methoxyphenyl)boronic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 500mg, 250mg, 1g, 100mg.
[5-(cyclopentylsulfamoyl)-2-methoxyphenyl]boronic acid (CAS 1704095-44-2) is a chemical compound with the molecular formula C12H18BNO5S and a molecular weight of 299.16 g/mol. IUPAC name: [5-(cyclopentylsulfamoyl)-2-methoxyphenyl]boronic acid. InChIKey: XJIYITKJDWOLOZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO5S |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | [5-(cyclopentylsulfamoyl)-2-methoxyphenyl]boronic acid |
| InChIKey | XJIYITKJDWOLOZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)NC2CCCC2)OC)(O)O |
Computed by PubChem (NCBI)