CAS 1704096-55-8 appears in our catalog under these names: (4-(N-Cyclopropylsulfamoyl)-3-fluorophenyl)boronic acid, 95%, (4-(N-cyclopropylsulfamoyl)-3-fluorophenyl)boronic acid, 98+%, (4–(N–Cyclopropylsulfamoyl)– 3–fluorophenyl)boronic acid, (4-(N-cyclopropylsulfamoyl)-3-fluorophenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[4-(cyclopropylsulfamoyl)-3-fluorophenyl]boronic acid (CAS 1704096-55-8) is a chemical compound with the molecular formula C9H11BFNO4S and a molecular weight of 259.07 g/mol. IUPAC name: [4-(cyclopropylsulfamoyl)-3-fluorophenyl]boronic acid. InChIKey: VGJJBKGUWRZZLA-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO4S |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | [4-(cyclopropylsulfamoyl)-3-fluorophenyl]boronic acid |
| InChIKey | VGJJBKGUWRZZLA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)NC2CC2)F)(O)O |
Computed by PubChem (NCBI)