Products 1704122-16-6
CAS 1704122-16-6 is the registry number for (5–((4–Ethylpiperazin–1–yl)sulfonyl) –2–methylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[5-(4-ethylpiperazin-1-yl)sulfonyl-2-methylphenyl]boronic acid (CAS 1704122-16-6) is a chemical compound with the molecular formula C13H21BN2O4S and a molecular weight of 312.2 g/mol. IUPAC name: [5-(4-ethylpiperazin-1-yl)sulfonyl-2-methylphenyl]boronic acid. InChIKey: QIERKTXDIBDJSR-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O4S |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | [5-(4-ethylpiperazin-1-yl)sulfonyl-2-methylphenyl]boronic acid |
| InChIKey | QIERKTXDIBDJSR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N2CCN(CC2)CC)C)(O)O |
Computed by PubChem (NCBI)