CAS 1704122-17-7 appears in our catalog under these names: 4-Borono-N,N,N-trimethylbenzenaminium iodide, 98%, 4-BORONO-N,N,N-TRIMETHYLBENZENAMINIUM IODIDE, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(4-boronophenyl)-trimethylazanium iodide (CAS 1704122-17-7) is a chemical compound with the molecular formula C9H15BINO2 and a molecular weight of 306.94 g/mol. IUPAC name: (4-boronophenyl)-trimethylazanium iodide. InChIKey: OXESOYOTRUMQSX-UHFFFAOYSA-M.
| Molecular formula | C9H15BINO2 |
|---|---|
| Molecular weight | 306.94 g/mol |
| IUPAC name | (4-boronophenyl)-trimethylazanium iodide |
| InChIKey | OXESOYOTRUMQSX-UHFFFAOYSA-M |
| SMILES | B(C1=CC=C(C=C1)[N+](C)(C)C)(O)O.[I-] |
Computed by PubChem (NCBI)