Products 170488-57-0
CAS 170488-57-0 is the registry number for Tubulin inhibitor 23. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[1-(benzenesulfonyl)indol-3-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (CAS 170488-57-0) is a chemical compound with the molecular formula C26H23NO6S and a molecular weight of 477.5 g/mol. IUPAC name: (E)-3-[1-(benzenesulfonyl)indol-3-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one. InChIKey: XYJOUBMOWIIIQS-BUHFOSPRSA-N.
| Molecular formula | C26H23NO6S |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (E)-3-[1-(benzenesulfonyl)indol-3-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | XYJOUBMOWIIIQS-BUHFOSPRSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)/C=C/C2=CN(C3=CC=CC=C32)S(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)