Products 1704963-78-9

CAS 1704963-78-9 is the registry number for (2R)-2-(tert-Butoxy)propanoic acid. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2R)-2-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 1704963-78-9) is a chemical compound with the molecular formula C7H14O3 and a molecular weight of 146.18 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: LLCMVSMCAHTTFZ-RXMQYKEDSA-N.

Identity
Molecular formulaC7H14O3
Molecular weight146.18 g/mol
IUPAC name(2R)-2-[(2-methylpropan-2-yl)oxy]propanoic acid
InChIKeyLLCMVSMCAHTTFZ-RXMQYKEDSA-N
SMILESC[C@H](C(=O)O)OC(C)(C)C

Computed by PubChem (NCBI)