CAS 17051-14-8 is the registry number for Perfluorotriphenylene. Offered by: TRC. Available pack sizes: 100mg.
1,2,3,4,5,6,7,8,9,10,11,12-dodecafluorotriphenylene (CAS 17051-14-8) is a chemical compound with the molecular formula C18F12 and a molecular weight of 444.2 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,10,11,12-dodecafluorotriphenylene. InChIKey: IMVCZNRQMXBQAI-UHFFFAOYSA-N.
| Molecular formula | C18F12 |
|---|---|
| Molecular weight | 444.2 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecafluorotriphenylene |
| InChIKey | IMVCZNRQMXBQAI-UHFFFAOYSA-N |
| SMILES | C12=C(C3=C(C4=C1C(=C(C(=C4F)F)F)F)C(=C(C(=C3F)F)F)F)C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)