Products 1705578-20-6
CAS 1705578-20-6 is the registry number for Potassium (3–((3–bromophenyl)amino) –3–oxopropyl)trifluoroborate. Offered by: GLPBio. Available pack sizes: 1g.
Potassium [3-(3-bromoanilino)-3-oxopropyl]-trifluoroboranuide (CAS 1705578-20-6) is a chemical compound with the molecular formula C9H9BBrF3KNO and a molecular weight of 333.98 g/mol. IUPAC name: potassium [3-(3-bromoanilino)-3-oxopropyl]-trifluoroboranuide. InChIKey: YSURZOZDXVTJKD-UHFFFAOYSA-N.
| Molecular formula | C9H9BBrF3KNO |
|---|---|
| Molecular weight | 333.98 g/mol |
| IUPAC name | potassium [3-(3-bromoanilino)-3-oxopropyl]-trifluoroboranuide |
| InChIKey | YSURZOZDXVTJKD-UHFFFAOYSA-N |
| SMILES | [B-](CCC(=O)NC1=CC(=CC=C1)Br)(F)(F)F.[K+] |
Computed by PubChem (NCBI)