CAS 1705578-42-2 is the registry number for Potassium trifluoro((isopropylamino)methyl)borate. Offered by: GLPBio. Available pack sizes: 500mg.
Potassium trifluoro-[(propan-2-ylamino)methyl]boranuide (CAS 1705578-42-2) is a chemical compound with the molecular formula C4H10BF3KN and a molecular weight of 179.04 g/mol. IUPAC name: potassium trifluoro-[(propan-2-ylamino)methyl]boranuide. InChIKey: PNRGJISTIGBEQE-UHFFFAOYSA-N.
| Molecular formula | C4H10BF3KN |
|---|---|
| Molecular weight | 179.04 g/mol |
| IUPAC name | potassium trifluoro-[(propan-2-ylamino)methyl]boranuide |
| InChIKey | PNRGJISTIGBEQE-UHFFFAOYSA-N |
| SMILES | [B-](CNC(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)